C21H21BrF3N3O3 — CID 16833474
2-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide (PubChem CID 16833474) has the molecular formula C21H21BrF3N3O3 and a molecular weight of 500.32 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide.
| Compound Name | 2-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide |
|---|---|
| PubChem CID | 16833474 |
| Molecular Formula | C21H21BrF3N3O3 |
| Molecular Weight | 500.32 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | 2-(4-nitrophenyl)-1-[3-(trifluoromethyl)phenyl]-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol bromide |
| SMILES | O=[N+]([O-])c1ccc(C2(O)C[N+]3=C(CCCCC3)N2c2cccc(C(F)(F)F)c2)cc1.[Br-] |
| InChI | InChI=1S/C21H21F3N3O3.BrH/c22-21(23,24)16-5-4-6-18(13-16)26-19-7-2-1-3-12-25(19)14-20(26,28)15-8-10-17(11-9-15)27(29)30;/h4-6,8-11,13,28H,1-3,7,12,14H2;1H/q+1;/p-1 |
| InChIKey | HVBXDQDTWMYSFE-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|