C21H21BrF3N2O+ — CID 3474053
3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 3474053) has the molecular formula C21H21BrF3N2O+ and a molecular weight of 454.31 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 3474053 |
| Molecular Formula | C21H21BrF3N2O+ |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-(4-bromophenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | OC1(c2ccc(Br)cc2)CN(c2cccc(C(F)(F)F)c2)C2=[N+]1CCCCC2 |
| InChI | InChI=1S/C21H21BrF3N2O/c22-17-10-8-15(9-11-17)20(28)14-26(19-7-2-1-3-12-27(19)20)18-6-4-5-16(13-18)21(23,24)25/h4-6,8-11,13,28H,1-3,7,12,14H2/q+1 |
| InChIKey | VOKMVWIOJGOVLC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|