C22H22F5N2O2+ — CID 34882863
(3S)-3-[4-(difluoromethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 34882863) has the molecular formula C22H22F5N2O2+ and a molecular weight of 441.42 g/mol. Its IUPAC name is (3S)-3-[4-(difluoromethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | (3S)-3-[4-(difluoromethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 34882863 |
| Molecular Formula | C22H22F5N2O2+ |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (3S)-3-[4-(difluoromethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | O[C@@]1(c2ccc(OC(F)F)cc2)CN(c2cccc(C(F)(F)F)c2)C2=[N+]1CCCCC2 |
| InChI | InChI=1S/C22H22F5N2O2/c23-20(24)31-18-10-8-15(9-11-18)21(30)14-28(19-7-2-1-3-12-29(19)21)17-6-4-5-16(13-17)22(25,26)27/h4-6,8-11,13,20,30H,1-3,7,12,14H2/q+1/t21-/m1/s1 |
| InChIKey | ZREOFERMENGWDG-OAQYLSRUSA-N |
| XLogP | 4.96 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|