C23H26BrF3N2O2 — CID 45135183
3-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide (PubChem CID 45135183) has the molecular formula C23H26BrF3N2O2 and a molecular weight of 499.37 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide.
| Compound Name | 3-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
|---|---|
| PubChem CID | 45135183 |
| Molecular Formula | C23H26BrF3N2O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[3-(trifluoromethyl)phenyl]-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol bromide |
| SMILES | CCOc1ccc(C2(O)CN(c3cccc(C(F)(F)F)c3)C3=[N+]2CCCCC3)cc1.[Br-] |
| InChI | InChI=1S/C23H26F3N2O2.BrH/c1-2-30-20-12-10-17(11-13-20)22(29)16-27(21-9-4-3-5-14-28(21)22)19-8-6-7-18(15-19)23(24,25)26;/h6-8,10-13,15,29H,2-5,9,14,16H2,1H3;1H/q+1;/p-1 |
| InChIKey | AAOZZCRNSSYRAH-UHFFFAOYSA-M |
| XLogP | 1.76 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|