C24H29N2O4+ — CID 7031371
(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-ethoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 7031371) has the molecular formula C24H29N2O4+ and a molecular weight of 409.51 g/mol. Its IUPAC name is (3S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-ethoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | (3S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-ethoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 7031371 |
| Molecular Formula | C24H29N2O4+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3S)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-ethoxyphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | CCOc1ccc(N2C[C@@](O)(c3ccc4c(c3)OCCO4)[N+]3=C2CCCCC3)cc1 |
| InChI | InChI=1S/C24H29N2O4/c1-2-28-20-10-8-19(9-11-20)25-17-24(27,26-13-5-3-4-6-23(25)26)18-7-12-21-22(16-18)30-15-14-29-21/h7-12,16,27H,2-6,13-15,17H2,1H3/q+1/t24-/m1/s1 |
| InChIKey | YHJCGKQMZWJOGY-XMMPIXPASA-N |
| XLogP | 3.51 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|