C28H31N2O2+ — CID 30284848
(3R)-1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol (PubChem CID 30284848) has the molecular formula C28H31N2O2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
|---|---|
| PubChem CID | 30284848 |
| Molecular Formula | C28H31N2O2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-3-(4-phenylphenyl)-2,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-3-ol |
| SMILES | CCOc1ccc(N2C[C@](O)(c3ccc(-c4ccccc4)cc3)[N+]3=C2CCCCC3)cc1 |
| InChI | InChI=1S/C28H31N2O2/c1-2-32-26-18-16-25(17-19-26)29-21-28(31,30-20-8-4-7-11-27(29)30)24-14-12-23(13-15-24)22-9-5-3-6-10-22/h3,5-6,9-10,12-19,31H,2,4,7-8,11,20-21H2,1H3/q+1/t28-/m0/s1 |
| InChIKey | NPSFPWWRHFBOPV-NDEPHWFRSA-N |
| XLogP | 5.40 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|