C19H15BrF3N3O2S — CID 45145313
3-methyl-5-(4-nitrophenyl)-7-[3-(trifluoromethyl)phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 45145313) has the molecular formula C19H15BrF3N3O2S and a molecular weight of 486.31 g/mol. Its IUPAC name is 3-methyl-5-(4-nitrophenyl)-7-[3-(trifluoromethyl)phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 3-methyl-5-(4-nitrophenyl)-7-[3-(trifluoromethyl)phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 45145313 |
| Molecular Formula | C19H15BrF3N3O2S |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 3-methyl-5-(4-nitrophenyl)-7-[3-(trifluoromethyl)phenyl]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | CC1CSc2n(-c3cccc(C(F)(F)F)c3)cc(-c3ccc([N+](=O)[O-])cc3)[n+]21.[Br-] |
| InChI | InChI=1S/C19H15F3N3O2S.BrH/c1-12-11-28-18-23(16-4-2-3-14(9-16)19(20,21)22)10-17(24(12)18)13-5-7-15(8-6-13)25(26)27;/h2-10,12H,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | AZFHMBGHZPCFCD-UHFFFAOYSA-M |
| XLogP | 2.03 |
| TPSA | 51.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|