C26H23F3N4O2S — CID 2743405
3-(4-tert-butylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 2743405) has the molecular formula C26H23F3N4O2S and a molecular weight of 512.56 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 3-(4-tert-butylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2743405 |
| Molecular Formula | C26H23F3N4O2S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-[(4-nitrophenyl)methylsulfanyl]-4-[3-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SCc3ccc([N+](=O)[O-])cc3)n2-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H23F3N4O2S/c1-25(2,3)19-11-9-18(10-12-19)23-30-31-24(36-16-17-7-13-21(14-8-17)33(34)35)32(23)22-6-4-5-20(15-22)26(27,28)29/h4-15H,16H2,1-3H3 |
| InChIKey | PSNIVCQKGOJHRC-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|