About 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine
3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine (PubChem CID 24905598) has the molecular formula C15H9F3N2O2S
and a molecular weight of 338.31 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine |
| PubChem CID | 24905598 |
| Molecular Formula | C15H9F3N2O2S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine |
| SMILES | O=[N+]([O-])c1ccc(C2=Nc3cc(C(F)(F)F)ccc3SC2)cc1 |
| InChI | InChI=1S/C15H9F3N2O2S/c16-15(17,18)10-3-6-14-12(7-10)19-13(8-23-14)9-1-4-11(5-2-9)20(21)22/h1-7H,8H2 |
| InChIKey | OUKULVHRQDUFNL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine?
The IUPAC name of 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine (CID 24905598) is 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine.
What is the SMILES notation for 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine?
The canonical SMILES for 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine is O=[N+]([O-])c1ccc(C2=Nc3cc(C(F)(F)F)ccc3SC2)cc1.
What is the InChIKey of 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine?
The InChIKey is OUKULVHRQDUFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N2O2S/c16-15(17,18)10-3-6-14-12(7-10)19-13(8-23-14)9-1-4-11(5-2-9)20(21)22/h1-7H,8H2.
What are the key properties of 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine?
3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine has a molecular weight of 338.31 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitrophenyl)-6-(trifluoromethyl)-2H-1,4-benzothiazine is sourced from PubChem (CID 24905598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).