C20H12N4O3 — CID 14040808
3-(4-nitrophenyl)-2H-[1,4]oxazino[2,3-b]phenazine (PubChem CID 14040808) has the molecular formula C20H12N4O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2H-[1,4]oxazino[2,3-b]phenazine.
| Compound Name | 3-(4-nitrophenyl)-2H-[1,4]oxazino[2,3-b]phenazine |
|---|---|
| PubChem CID | 14040808 |
| Molecular Formula | C20H12N4O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-(4-nitrophenyl)-2H-[1,4]oxazino[2,3-b]phenazine |
| SMILES | O=[N+]([O-])c1ccc(C2=Nc3cc4nc5ccccc5nc4cc3OC2)cc1 |
| InChI | InChI=1S/C20H12N4O3/c25-24(26)13-7-5-12(6-8-13)19-11-27-20-10-17-16(9-18(20)23-19)21-14-3-1-2-4-15(14)22-17/h1-10H,11H2 |
| InChIKey | IRRWAOOFAQMOHJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|