C44H34N4O4S2 — CID 11614691
2-(4-nitrophenyl)-4-[4-[2-[4-[2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenyl]ethyl]phenyl]-2,3-dihydro-1,5-benzothiazepine (PubChem CID 11614691) has the molecular formula C44H34N4O4S2 and a molecular weight of 746.91 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-4-[4-[2-[4-[2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenyl]ethyl]phenyl]-2,3-dihydro-1,5-benzothiazepine.
| Compound Name | 2-(4-nitrophenyl)-4-[4-[2-[4-[2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenyl]ethyl]phenyl]-2,3-dihydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 11614691 |
| Molecular Formula | C44H34N4O4S2 |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | 2-(4-nitrophenyl)-4-[4-[2-[4-[2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-4-yl]phenyl]ethyl]phenyl]-2,3-dihydro-1,5-benzothiazepine |
| SMILES | O=[N+]([O-])c1ccc(C2CC(c3ccc(CCc4ccc(C5=Nc6ccccc6SC(c6ccc([N+](=O)[O-])cc6)C5)cc4)cc3)=Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C44H34N4O4S2/c49-47(50)35-23-19-33(20-24-35)43-27-39(45-37-5-1-3-7-41(37)53-43)31-15-11-29(12-16-31)9-10-30-13-17-32(18-14-30)40-28-44(34-21-25-36(26-22-34)48(51)52)54-42-8-4-2-6-38(42)46-40/h1-8,11-26,43-44H,9-10,27-28H2 |
| InChIKey | ZQFMUTHWARFPKC-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|