C21H14Cl2N2O3S — CID 10939194
4-(2,4-dichlorophenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-7-ol (PubChem CID 10939194) has the molecular formula C21H14Cl2N2O3S and a molecular weight of 445.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-7-ol.
| Compound Name | 4-(2,4-dichlorophenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-7-ol |
|---|---|
| PubChem CID | 10939194 |
| Molecular Formula | C21H14Cl2N2O3S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepin-7-ol |
| SMILES | O=[N+]([O-])c1ccc(C2CC(c3ccc(Cl)cc3Cl)=Nc3cc(O)ccc3S2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O3S/c22-13-3-7-16(17(23)9-13)18-11-21(12-1-4-14(5-2-12)25(27)28)29-20-8-6-15(26)10-19(20)24-18/h1-10,21,26H,11H2 |
| InChIKey | MJROMIHZFWQALB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|