C15H11ClN3O3- — CID 6945530
2-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenolate (PubChem CID 6945530) has the molecular formula C15H11ClN3O3- and a molecular weight of 316.72 g/mol. Its IUPAC name is 2-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenolate.
| Compound Name | 2-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6945530 |
| Molecular Formula | C15H11ClN3O3- |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-nitrophenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(C2=NN[C@@H](c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C15H12ClN3O3/c16-10-3-1-9(2-4-10)13-8-14(18-17-13)12-7-11(19(21)22)5-6-15(12)20/h1-7,13,17,20H,8H2/p-1/t13-/m1/s1 |
| InChIKey | SZBVFVPXMNFQEE-CYBMUJFWSA-M |
| XLogP | 2.76 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|