C15H12N4O4 — CID 100816860
(5R)-3,5-bis(4-nitrophenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 100816860) has the molecular formula C15H12N4O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is (5R)-3,5-bis(4-nitrophenyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | (5R)-3,5-bis(4-nitrophenyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 100816860 |
| Molecular Formula | C15H12N4O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (5R)-3,5-bis(4-nitrophenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1ccc(C2=NN[C@@H](c3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C15H12N4O4/c20-18(21)12-5-1-10(2-6-12)14-9-15(17-16-14)11-3-7-13(8-4-11)19(22)23/h1-8,14,16H,9H2/t14-/m1/s1 |
| InChIKey | PRYHMDUYUTYJGZ-CQSZACIVSA-N |
| XLogP | 2.94 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|