C21H16N4O3 — CID 11360768
2-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]benzo[e][1]benzofuran-1-amine (PubChem CID 11360768) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]benzo[e][1]benzofuran-1-amine.
| Compound Name | 2-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]benzo[e][1]benzofuran-1-amine |
|---|---|
| PubChem CID | 11360768 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]benzo[e][1]benzofuran-1-amine |
| SMILES | Nc1c(C2=NNC(c3ccc([N+](=O)[O-])cc3)C2)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C21H16N4O3/c22-20-19-15-4-2-1-3-12(15)7-10-18(19)28-21(20)17-11-16(23-24-17)13-5-8-14(9-6-13)25(26)27/h1-10,16,23H,11,22H2 |
| InChIKey | CRDHWBUZKAFJBP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|