About 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol
1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol (PubChem CID 137156212) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol |
| PubChem CID | 137156212 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol |
| SMILES | Oc1ccc(C2CC(c3c(O)ccc4ccccc34)=NN2)cc1 |
| InChI | InChI=1S/C19H16N2O2/c22-14-8-5-13(6-9-14)16-11-17(21-20-16)19-15-4-2-1-3-12(15)7-10-18(19)23/h1-10,16,20,22-23H,11H2 |
| InChIKey | QGZGVMLOZJGUAA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol?
The IUPAC name of 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol (CID 137156212) is 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol.
What is the SMILES notation for 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol?
The canonical SMILES for 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol is Oc1ccc(C2CC(c3c(O)ccc4ccccc34)=NN2)cc1.
What is the InChIKey of 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol?
The InChIKey is QGZGVMLOZJGUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2/c22-14-8-5-13(6-9-14)16-11-17(21-20-16)19-15-4-2-1-3-12(15)7-10-18(19)23/h1-10,16,20,22-23H,11H2.
What are the key properties of 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol?
1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol has a molecular weight of 304.35 g/mol, XLogP of 3.69, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-hydroxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]naphthalen-2-ol is sourced from PubChem (CID 137156212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).