C20H17N5O5 — CID 135969999
1-benzyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione (PubChem CID 135969999) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is 1-benzyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135969999 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 1-benzyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c(O)c1C1=NNC(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H17N5O5/c26-18-17(19(27)24(20(28)21-18)11-12-4-2-1-3-5-12)16-10-15(22-23-16)13-6-8-14(9-7-13)25(29)30/h1-9,15,22,27H,10-11H2,(H,21,26,28) |
| InChIKey | LVPCRYRUGHNBKJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|