C17H19N5O5 — CID 135969964
1-butyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione (PubChem CID 135969964) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione.
| Compound Name | 1-butyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135969964 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[5-(4-nitrophenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(O)c(C2=NNC(c3ccc([N+](=O)[O-])cc3)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H19N5O5/c1-2-3-8-21-16(24)14(15(23)18-17(21)25)13-9-12(19-20-13)10-4-6-11(7-5-10)22(26)27/h4-7,12,19,24H,2-3,8-9H2,1H3,(H,18,23,25) |
| InChIKey | MXGSTTYUMADMGR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|