C17H18N4O4 — CID 136804422
6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 136804422) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136804422 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(C2=NN[C@H](c3ccc(OC)cc3)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N4O4/c1-3-8-21-16(23)14(15(22)18-17(21)24)13-9-12(19-20-13)10-4-6-11(25-2)7-5-10/h3-7,12,19,23H,1,8-9H2,2H3,(H,18,22,24)/t12-/m0/s1 |
| InChIKey | MXKRLZJZRKHMBV-LBPRGKRZSA-N |
| XLogP | 0.88 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|