C17H16N4O5 — CID 135676469
5-[(5R)-5-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione (PubChem CID 135676469) has the molecular formula C17H16N4O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is 5-[(5R)-5-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione.
| Compound Name | 5-[(5R)-5-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135676469 |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-[(5R)-5-(1,3-benzodioxol-5-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-prop-2-enylpyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(C2=NN[C@@H](c3ccc4c(c3)OCO4)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H16N4O5/c1-2-5-21-16(23)14(15(22)18-17(21)24)11-7-10(19-20-11)9-3-4-12-13(6-9)26-8-25-12/h2-4,6,10,19,23H,1,5,7-8H2,(H,18,22,24)/t10-/m1/s1 |
| InChIKey | QYEXNKNWYJRMOY-SNVBAGLBSA-N |
| XLogP | 0.60 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|