C19H22N4O6 — CID 136804430
6-hydroxy-1-prop-2-enyl-5-[(5S)-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione (PubChem CID 136804430) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 6-hydroxy-1-prop-2-enyl-5-[(5S)-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-prop-2-enyl-5-[(5S)-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136804430 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-hydroxy-1-prop-2-enyl-5-[(5S)-5-(2,3,4-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(O)c(C2=NN[C@H](c3ccc(OC)c(OC)c3OC)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H22N4O6/c1-5-8-23-18(25)14(17(24)20-19(23)26)12-9-11(21-22-12)10-6-7-13(27-2)16(29-4)15(10)28-3/h5-7,11,21,25H,1,8-9H2,2-4H3,(H,20,24,26)/t11-/m0/s1 |
| InChIKey | NWASDCLKNAWBBR-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|