C18H22N4O5 — CID 135577620
6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-(3-methoxypropyl)pyrimidine-2,4-dione (PubChem CID 135577620) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-(3-methoxypropyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-(3-methoxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135577620 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 6-hydroxy-5-[(5S)-5-(4-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-1-(3-methoxypropyl)pyrimidine-2,4-dione |
| SMILES | COCCCn1c(O)c(C2=NN[C@H](c3ccc(OC)cc3)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N4O5/c1-26-9-3-8-22-17(24)15(16(23)19-18(22)25)14-10-13(20-21-14)11-4-6-12(27-2)7-5-11/h4-7,13,20,24H,3,8-10H2,1-2H3,(H,19,23,25)/t13-/m0/s1 |
| InChIKey | STPGDDZPAWNZKL-ZDUSSCGKSA-N |
| XLogP | 0.73 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|