C26H27N5O4 — CID 136767571
5-[(5S)-5-(1-benzylindol-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione (PubChem CID 136767571) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-[(5S)-5-(1-benzylindol-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(5S)-5-(1-benzylindol-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136767571 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 5-[(5S)-5-(1-benzylindol-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]-6-hydroxy-1-(3-methoxypropyl)pyrimidine-2,4-dione |
| SMILES | COCCCn1c(O)c(C2=NN[C@H](c3cn(Cc4ccccc4)c4ccccc34)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H27N5O4/c1-35-13-7-12-31-25(33)23(24(32)27-26(31)34)21-14-20(28-29-21)19-16-30(15-17-8-3-2-4-9-17)22-11-6-5-10-18(19)22/h2-6,8-11,16,20,28,33H,7,12-15H2,1H3,(H,27,32,34)/t20-/m0/s1 |
| InChIKey | QVBWEPWZNYFECY-FQEVSTJZSA-N |
| XLogP | 2.72 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|