C18H22N4O3S — CID 136887998
1-butyl-6-hydroxy-5-[(5S)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 136887998) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 1-butyl-6-hydroxy-5-[(5S)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-butyl-6-hydroxy-5-[(5S)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 136887998 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-butyl-6-hydroxy-5-[(5S)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-3-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCn1c(O)c(C2=NN[C@H](c3ccccc3OC)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C18H22N4O3S/c1-3-4-9-22-17(24)15(16(23)19-18(22)26)13-10-12(20-21-13)11-7-5-6-8-14(11)25-2/h5-8,12,20,24H,3-4,9-10H2,1-2H3,(H,19,23,26)/t12-/m0/s1 |
| InChIKey | ZVIFHKWVPBWHKK-LBPRGKRZSA-N |
| XLogP | 2.86 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|