C30H16N2O6 — CID 71605507
15-(4-nitrophenyl)-12,18-dioxa-15-azahexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),20,22,24,26-undecaene-14,16-dione (PubChem CID 71605507) has the molecular formula C30H16N2O6 and a molecular weight of 500.47 g/mol. Its IUPAC name is 15-(4-nitrophenyl)-12,18-dioxa-15-azahexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),20,22,24,26-undecaene-14,16-dione.
| Compound Name | 15-(4-nitrophenyl)-12,18-dioxa-15-azahexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),20,22,24,26-undecaene-14,16-dione |
|---|---|
| PubChem CID | 71605507 |
| Molecular Formula | C30H16N2O6 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 15-(4-nitrophenyl)-12,18-dioxa-15-azahexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),20,22,24,26-undecaene-14,16-dione |
| SMILES | O=C1c2oc3ccc4ccccc4c3c3c(ccc4ccccc43)oc2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H16N2O6/c33-29-27-28(30(34)31(29)19-11-13-20(14-12-19)32(35)36)38-24-16-10-18-6-2-4-8-22(18)26(24)25-21-7-3-1-5-17(21)9-15-23(25)37-27/h1-16H |
| InChIKey | MVCMDCOOYLUMMG-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 106.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|