C25H20N2O6 — CID 166163576
ethyl 2-[4-(naphthalen-2-ylmethyl)-1-(4-nitrophenyl)-2,5-dioxopyrrol-3-yl]acetate (PubChem CID 166163576) has the molecular formula C25H20N2O6 and a molecular weight of 444.44 g/mol. Its IUPAC name is ethyl 2-[4-(naphthalen-2-ylmethyl)-1-(4-nitrophenyl)-2,5-dioxopyrrol-3-yl]acetate.
| Compound Name | ethyl 2-[4-(naphthalen-2-ylmethyl)-1-(4-nitrophenyl)-2,5-dioxopyrrol-3-yl]acetate |
|---|---|
| PubChem CID | 166163576 |
| Molecular Formula | C25H20N2O6 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | ethyl 2-[4-(naphthalen-2-ylmethyl)-1-(4-nitrophenyl)-2,5-dioxopyrrol-3-yl]acetate |
| SMILES | CCOC(=O)CC1=C(Cc2ccc3ccccc3c2)C(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C25H20N2O6/c1-2-33-23(28)15-22-21(14-16-7-8-17-5-3-4-6-18(17)13-16)24(29)26(25(22)30)19-9-11-20(12-10-19)27(31)32/h3-13H,2,14-15H2,1H3 |
| InChIKey | LXLQACDDBPXTRW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|