C16H15ClN2O2 — CID 136670257
2-[(5S)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol (PubChem CID 136670257) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-[(5S)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol.
| Compound Name | 2-[(5S)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 136670257 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(5S)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C2=NN[C@H](c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C16H15ClN2O2/c1-21-12-6-7-16(20)13(8-12)15-9-14(18-19-15)10-2-4-11(17)5-3-10/h2-8,14,18,20H,9H2,1H3/t14-/m0/s1 |
| InChIKey | QHIOSDYSURDXJN-AWEZNQCLSA-N |
| XLogP | 3.49 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|