C22H22N2O4 — CID 142742285
2-[5-(2,3-dimethoxynaphthalen-1-yl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol (PubChem CID 142742285) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-[5-(2,3-dimethoxynaphthalen-1-yl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol.
| Compound Name | 2-[5-(2,3-dimethoxynaphthalen-1-yl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 142742285 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[5-(2,3-dimethoxynaphthalen-1-yl)-4,5-dihydro-1H-pyrazol-3-yl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C2=NNC(c3c(OC)c(OC)cc4ccccc34)C2)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-26-14-8-9-19(25)16(11-14)17-12-18(24-23-17)21-15-7-5-4-6-13(15)10-20(27-2)22(21)28-3/h4-11,18,24-25H,12H2,1-3H3 |
| InChIKey | WULAALODVLUYID-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|