C21H20N2O3 — CID 142742283
4,5-dimethoxy-2-(5-naphthalen-1-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol (PubChem CID 142742283) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(5-naphthalen-1-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol.
| Compound Name | 4,5-dimethoxy-2-(5-naphthalen-1-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol |
|---|---|
| PubChem CID | 142742283 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4,5-dimethoxy-2-(5-naphthalen-1-yl-4,5-dihydro-1H-pyrazol-3-yl)phenol |
| SMILES | COc1cc(O)c(C2=NNC(c3cccc4ccccc34)C2)cc1OC |
| InChI | InChI=1S/C21H20N2O3/c1-25-20-10-16(19(24)12-21(20)26-2)18-11-17(22-23-18)15-9-5-7-13-6-3-4-8-14(13)15/h3-10,12,17,22,24H,11H2,1-2H3 |
| InChIKey | WBLVRABRPREETR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|