C15H11Cl3N2O — CID 135597142
2,4-dichloro-6-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol (PubChem CID 135597142) has the molecular formula C15H11Cl3N2O and a molecular weight of 341.63 g/mol. Its IUPAC name is 2,4-dichloro-6-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol.
| Compound Name | 2,4-dichloro-6-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 135597142 |
| Molecular Formula | C15H11Cl3N2O |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2,4-dichloro-6-[(5R)-5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1C1=NN[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H11Cl3N2O/c16-9-3-1-8(2-4-9)13-7-14(20-19-13)11-5-10(17)6-12(18)15(11)21/h1-6,13,19,21H,7H2/t13-/m1/s1 |
| InChIKey | GAPRSYVKBMTILY-CYBMUJFWSA-N |
| XLogP | 4.79 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|