C17H12Cl2N4 — CID 176900311
6-[3-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]quinoxaline (PubChem CID 176900311) has the molecular formula C17H12Cl2N4 and a molecular weight of 343.22 g/mol. Its IUPAC name is 6-[3-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]quinoxaline.
| Compound Name | 6-[3-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]quinoxaline |
|---|---|
| PubChem CID | 176900311 |
| Molecular Formula | C17H12Cl2N4 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 6-[3-(2,4-dichlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]quinoxaline |
| SMILES | Clc1ccc(C2=NNC(c3ccc4nccnc4c3)C2)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N4/c18-11-2-3-12(13(19)8-11)16-9-15(22-23-16)10-1-4-14-17(7-10)21-6-5-20-14/h1-8,15,22H,9H2 |
| InChIKey | RLJDOUPCJAIQSX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |