C9H6Cl2N2S — CID 144921488
3-(2,4-dichlorophenyl)-1,4-dihydropyrazole-5-thione (PubChem CID 144921488) has the molecular formula C9H6Cl2N2S and a molecular weight of 245.13 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1,4-dihydropyrazole-5-thione.
| Compound Name | 3-(2,4-dichlorophenyl)-1,4-dihydropyrazole-5-thione |
|---|---|
| PubChem CID | 144921488 |
| Molecular Formula | C9H6Cl2N2S |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 243.96 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1,4-dihydropyrazole-5-thione |
| SMILES | S=C1CC(c2ccc(Cl)cc2Cl)=NN1 |
| InChI | InChI=1S/C9H6Cl2N2S/c10-5-1-2-6(7(11)3-5)8-4-9(14)13-12-8/h1-3H,4H2,(H,13,14) |
| InChIKey | ZVNSKIURKCJPGS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|