C22H18N2O3S — CID 14225908
4-(4-methoxyphenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepine (PubChem CID 14225908) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepine.
| Compound Name | 4-(4-methoxyphenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 14225908 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(4-nitrophenyl)-2,3-dihydro-1,5-benzothiazepine |
| SMILES | COc1ccc(C2=Nc3ccccc3SC(c3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-27-18-12-8-15(9-13-18)20-14-22(16-6-10-17(11-7-16)24(25)26)28-21-5-3-2-4-19(21)23-20/h2-13,22H,14H2,1H3 |
| InChIKey | GUYJCADKHSQJAH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|