C17H17N3O2S — CID 8006961
(5S)-5-(4-nitrophenyl)-N-(2-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 8006961) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is (5S)-5-(4-nitrophenyl)-N-(2-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (5S)-5-(4-nitrophenyl)-N-(2-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8006961 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (5S)-5-(4-nitrophenyl)-N-(2-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc([C@H]2CN=C(NCCc3ccccc3)S2)cc1 |
| InChI | InChI=1S/C17H17N3O2S/c21-20(22)15-8-6-14(7-9-15)16-12-19-17(23-16)18-11-10-13-4-2-1-3-5-13/h1-9,16H,10-12H2,(H,18,19)/t16-/m1/s1 |
| InChIKey | PXJYEVDVCITNFI-MRXNPFEDSA-N |
| XLogP | 3.57 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|