C16H12Cl3N3O2 — CID 7164462
(2R)-4-(4-nitrophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine (PubChem CID 7164462) has the molecular formula C16H12Cl3N3O2 and a molecular weight of 384.65 g/mol. Its IUPAC name is (2R)-4-(4-nitrophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine.
| Compound Name | (2R)-4-(4-nitrophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 7164462 |
| Molecular Formula | C16H12Cl3N3O2 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | (2R)-4-(4-nitrophenyl)-2-(trichloromethyl)-2,3-dihydro-1H-1,5-benzodiazepine |
| SMILES | O=[N+]([O-])c1ccc(C2=Nc3ccccc3N[C@@H](C(Cl)(Cl)Cl)C2)cc1 |
| InChI | InChI=1S/C16H12Cl3N3O2/c17-16(18,19)15-9-14(10-5-7-11(8-6-10)22(23)24)20-12-3-1-2-4-13(12)21-15/h1-8,15,21H,9H2/t15-/m1/s1 |
| InChIKey | HBEYKTBYZQBIQP-OAHLLOKOSA-N |
| XLogP | 5.27 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|