C9H8N2O3 — CID 101036321
(4S,5R)-4,5-dideuterio-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 101036321) has the molecular formula C9H8N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is (4S,5R)-4,5-dideuterio-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5R)-4,5-dideuterio-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 101036321 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (4S,5R)-4,5-dideuterio-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | [2H][C@H]1ON=C(c2ccc([N+](=O)[O-])cc2)[C@@H]1[2H] |
| InChI | InChI=1S/C9H8N2O3/c12-11(13)8-3-1-7(2-4-8)9-5-6-14-10-9/h1-4H,5-6H2/i5D,6D/t5-,6-/m1/s1 |
| InChIKey | VGXUSRMIOTXWCB-TZYORUCZSA-N |
| XLogP | 1.72 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|