C13H16N2O3 — CID 141299123
5-tert-butyl-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 141299123) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-tert-butyl-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-tert-butyl-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 141299123 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 5-tert-butyl-3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | CC(C)(C)C1CC(c2ccc([N+](=O)[O-])cc2)=NO1 |
| InChI | InChI=1S/C13H16N2O3/c1-13(2,3)12-8-11(14-18-12)9-4-6-10(7-5-9)15(16)17/h4-7,12H,8H2,1-3H3 |
| InChIKey | BTACVDJDPPXUNQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|