C25H32N2O5 — CID 135673962
2,6-ditert-butyl-4-[5-[2-(4-nitrophenoxy)ethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenol (PubChem CID 135673962) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[5-[2-(4-nitrophenoxy)ethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[5-[2-(4-nitrophenoxy)ethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenol |
|---|---|
| PubChem CID | 135673962 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2,6-ditert-butyl-4-[5-[2-(4-nitrophenoxy)ethyl]-4,5-dihydro-1,2-oxazol-3-yl]phenol |
| SMILES | CC(C)(C)c1cc(C2=NOC(CCOc3ccc([N+](=O)[O-])cc3)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H32N2O5/c1-24(2,3)20-13-16(14-21(23(20)28)25(4,5)6)22-15-19(32-26-22)11-12-31-18-9-7-17(8-10-18)27(29)30/h7-10,13-14,19,28H,11-12,15H2,1-6H3 |
| InChIKey | KTQRHYQENKLDJF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|