C24H30N4O3 — CID 87651029
2,6-ditert-butyl-4-[2-[(4-nitroanilino)methyl]-1H-imidazol-5-yl]phenol (PubChem CID 87651029) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[(4-nitroanilino)methyl]-1H-imidazol-5-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[(4-nitroanilino)methyl]-1H-imidazol-5-yl]phenol |
|---|---|
| PubChem CID | 87651029 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[(4-nitroanilino)methyl]-1H-imidazol-5-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cnc(CNc3ccc([N+](=O)[O-])cc3)[nH]2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H30N4O3/c1-23(2,3)18-11-15(12-19(22(18)29)24(4,5)6)20-13-26-21(27-20)14-25-16-7-9-17(10-8-16)28(30)31/h7-13,25,29H,14H2,1-6H3,(H,26,27) |
| InChIKey | BSMSRBFAEXLHAX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|