C20H14ClN3O4 — CID 101268740
3-(4-chlorophenyl)-5-[(E)-2-[3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethenyl]-1,2-oxazole (PubChem CID 101268740) has the molecular formula C20H14ClN3O4 and a molecular weight of 395.80 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(E)-2-[3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethenyl]-1,2-oxazole.
| Compound Name | 3-(4-chlorophenyl)-5-[(E)-2-[3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 101268740 |
| Molecular Formula | C20H14ClN3O4 |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(E)-2-[3-(4-nitrophenyl)-4,5-dihydro-1,2-oxazol-5-yl]ethenyl]-1,2-oxazole |
| SMILES | O=[N+]([O-])c1ccc(C2=NOC(/C=C/c3cc(-c4ccc(Cl)cc4)no3)C2)cc1 |
| InChI | InChI=1S/C20H14ClN3O4/c21-15-5-1-13(2-6-15)19-11-17(27-22-19)9-10-18-12-20(23-28-18)14-3-7-16(8-4-14)24(25)26/h1-11,18H,12H2/b10-9+ |
| InChIKey | SGOMTKLDYDBLGT-MDZDMXLPSA-N |
| XLogP | 5.11 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|