C20H16N4O6 — CID 68757332
1-[3-(4-aminophenyl)-1,2-oxazol-5-yl]-2-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]ethane-1,2-diol (PubChem CID 68757332) has the molecular formula C20H16N4O6 and a molecular weight of 408.37 g/mol. Its IUPAC name is 1-[3-(4-aminophenyl)-1,2-oxazol-5-yl]-2-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]ethane-1,2-diol.
| Compound Name | 1-[3-(4-aminophenyl)-1,2-oxazol-5-yl]-2-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 68757332 |
| Molecular Formula | C20H16N4O6 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 1-[3-(4-aminophenyl)-1,2-oxazol-5-yl]-2-[3-(4-nitrophenyl)-1,2-oxazol-5-yl]ethane-1,2-diol |
| SMILES | Nc1ccc(-c2cc(C(O)C(O)c3cc(-c4ccc([N+](=O)[O-])cc4)no3)on2)cc1 |
| InChI | InChI=1S/C20H16N4O6/c21-13-5-1-11(2-6-13)15-9-17(29-22-15)19(25)20(26)18-10-16(23-30-18)12-3-7-14(8-4-12)24(27)28/h1-10,19-20,25-26H,21H2 |
| InChIKey | WJOHZLXSPAVZJN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|