C20H22N3O4+ — CID 1420768
(2S)-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 1420768) has the molecular formula C20H22N3O4+ and a molecular weight of 368.41 g/mol. Its IUPAC name is (2S)-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
| Compound Name | (2S)-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
|---|---|
| PubChem CID | 1420768 |
| Molecular Formula | C20H22N3O4+ |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2S)-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | COc1ccc(N2C3=[N+](CCCC3)C[C@@]2(O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H22N3O4/c1-27-18-10-8-16(9-11-18)22-19-7-2-3-12-21(19)14-20(22,24)15-5-4-6-17(13-15)23(25)26/h4-6,8-11,13,24H,2-3,7,12,14H2,1H3/q+1/t20-/m1/s1 |
| InChIKey | BUAGDZXBZRLSJI-HXUWFJFHSA-N |
| XLogP | 2.86 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|