C26H27N2O2+ — CID 6998818
(2R,5R)-1-(4-methoxyphenyl)-2,5-diphenyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol (PubChem CID 6998818) has the molecular formula C26H27N2O2+ and a molecular weight of 399.51 g/mol. Its IUPAC name is (2R,5R)-1-(4-methoxyphenyl)-2,5-diphenyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol.
| Compound Name | (2R,5R)-1-(4-methoxyphenyl)-2,5-diphenyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
|---|---|
| PubChem CID | 6998818 |
| Molecular Formula | C26H27N2O2+ |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (2R,5R)-1-(4-methoxyphenyl)-2,5-diphenyl-5,6,7,8-tetrahydro-3H-imidazo[1,2-a]pyridin-4-ium-2-ol |
| SMILES | COc1ccc(N2C3=[N+](C[C@]2(O)c2ccccc2)[C@@H](c2ccccc2)CCC3)cc1 |
| InChI | InChI=1S/C26H27N2O2/c1-30-23-17-15-22(16-18-23)28-25-14-8-13-24(20-9-4-2-5-10-20)27(25)19-26(28,29)21-11-6-3-7-12-21/h2-7,9-12,15-18,24,29H,8,13-14,19H2,1H3/q+1/t24-,26+/m1/s1 |
| InChIKey | JIFLUGFVMSJMJQ-RSXGOPAZSA-N |
| XLogP | 4.70 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|