C22H26FN2O3+ — CID 25273716
(2R)-2-(2-fluoro-4-methoxyphenyl)-1-(4-methoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 25273716) has the molecular formula C22H26FN2O3+ and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R)-2-(2-fluoro-4-methoxyphenyl)-1-(4-methoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | (2R)-2-(2-fluoro-4-methoxyphenyl)-1-(4-methoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 25273716 |
| Molecular Formula | C22H26FN2O3+ |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2R)-2-(2-fluoro-4-methoxyphenyl)-1-(4-methoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | COc1ccc(N2C3=[N+](CCCCC3)C[C@]2(O)c2ccc(OC)cc2F)cc1 |
| InChI | InChI=1S/C22H26FN2O3/c1-27-17-9-7-16(8-10-17)25-21-6-4-3-5-13-24(21)15-22(25,26)19-12-11-18(28-2)14-20(19)23/h7-12,14,26H,3-6,13,15H2,1-2H3/q+1/t22-/m0/s1 |
| InChIKey | BRYNPUZCYVHMOL-QFIPXVFZSA-N |
| XLogP | 3.49 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|