C23H29N2O2+ — CID 4606782
2-(4-ethoxyphenyl)-1-(4-methylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 4606782) has the molecular formula C23H29N2O2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-(4-methylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | 2-(4-ethoxyphenyl)-1-(4-methylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 4606782 |
| Molecular Formula | C23H29N2O2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-(4-methylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | CCOc1ccc(C2(O)C[N+]3=C(CCCCC3)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H29N2O2/c1-3-27-21-14-10-19(11-15-21)23(26)17-24-16-6-4-5-7-22(24)25(23)20-12-8-18(2)9-13-20/h8-15,26H,3-7,16-17H2,1-2H3/q+1 |
| InChIKey | OWTQNOTUBGZRSO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|