C27H29N2O+ — CID 4177665
1-(4-methylphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 4177665) has the molecular formula C27H29N2O+ and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | 1-(4-methylphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 4177665 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-(4-methylphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | Cc1ccc(N2C3=[N+](CCCCC3)CC2(O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H29N2O/c1-21-11-17-25(18-12-21)29-26-10-6-3-7-19-28(26)20-27(29,30)24-15-13-23(14-16-24)22-8-4-2-5-9-22/h2,4-5,8-9,11-18,30H,3,6-7,10,19-20H2,1H3/q+1 |
| InChIKey | LGWLGGJAFGWMQU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|