C27H29N2O2+ — CID 4550405
1-(2-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 4550405) has the molecular formula C27H29N2O2+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | 1-(2-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 4550405 |
| Molecular Formula | C27H29N2O2+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-(4-phenylphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | COc1ccccc1N1C2=[N+](CCCCC2)CC1(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N2O2/c1-31-25-13-8-7-12-24(25)29-26-14-6-3-9-19-28(26)20-27(29,30)23-17-15-22(16-18-23)21-10-4-2-5-11-21/h2,4-5,7-8,10-13,15-18,30H,3,6,9,14,19-20H2,1H3/q+1 |
| InChIKey | QXEFJTDATMWXKM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|