C23H24ClN4O2+ — CID 21205197
5-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-2-phenyl-4H-pyrazol-3-one (PubChem CID 21205197) has the molecular formula C23H24ClN4O2+ and a molecular weight of 423.92 g/mol. Its IUPAC name is 5-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-2-phenyl-4H-pyrazol-3-one.
| Compound Name | 5-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-2-phenyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 21205197 |
| Molecular Formula | C23H24ClN4O2+ |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 5-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-2-phenyl-4H-pyrazol-3-one |
| SMILES | O=C1CC(N2C3=[N+](CCCCC3)CC2(O)c2ccc(Cl)cc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C23H24ClN4O2/c24-18-12-10-17(11-13-18)23(30)16-26-14-6-2-5-9-21(26)27(23)20-15-22(29)28(25-20)19-7-3-1-4-8-19/h1,3-4,7-8,10-13,30H,2,5-6,9,14-16H2/q+1 |
| InChIKey | CXYRHXUNUCWMLQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|