C25H28ClN4O2+ — CID 21179338
4-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 21179338) has the molecular formula C25H28ClN4O2+ and a molecular weight of 451.98 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 21179338 |
| Molecular Formula | C25H28ClN4O2+ |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-2-hydroxy-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-1-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(N2C3=[N+](CCCCC3)CC2(O)c2ccc(Cl)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H28ClN4O2/c1-18-23(24(31)30(27(18)2)21-9-5-3-6-10-21)29-22-11-7-4-8-16-28(22)17-25(29,32)19-12-14-20(26)15-13-19/h3,5-6,9-10,12-15,32H,4,7-8,11,16-17H2,1-2H3/q+1 |
| InChIKey | ORZKWXUBURUARF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|