C22H27N2O3+ — CID 2337397
(2S,3R)-2-(4-ethoxyphenyl)-1-(4-methoxyphenyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-a]imidazol-4-ium-2-ol (PubChem CID 2337397) has the molecular formula C22H27N2O3+ and a molecular weight of 367.47 g/mol. Its IUPAC name is (2S,3R)-2-(4-ethoxyphenyl)-1-(4-methoxyphenyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-a]imidazol-4-ium-2-ol.
| Compound Name | (2S,3R)-2-(4-ethoxyphenyl)-1-(4-methoxyphenyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-a]imidazol-4-ium-2-ol |
|---|---|
| PubChem CID | 2337397 |
| Molecular Formula | C22H27N2O3+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (2S,3R)-2-(4-ethoxyphenyl)-1-(4-methoxyphenyl)-3-methyl-3,5,6,7-tetrahydropyrrolo[1,2-a]imidazol-4-ium-2-ol |
| SMILES | CCOc1ccc([C@]2(O)[C@@H](C)[N+]3=C(CCC3)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H27N2O3/c1-4-27-20-11-7-17(8-12-20)22(25)16(2)23-15-5-6-21(23)24(22)18-9-13-19(26-3)14-10-18/h7-14,16,25H,4-6,15H2,1-3H3/q+1/t16-,22-/m1/s1 |
| InChIKey | ZIYMBADOEKPYBI-OPAMFIHVSA-N |
| XLogP | 3.35 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|